C12H14N2O2S — CID 117379404
4-amino-4-(2-methyl-1,3-benzothiazol-5-yl)butanoic acid (PubChem CID 117379404) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-amino-4-(2-methyl-1,3-benzothiazol-5-yl)butanoic acid.
| Compound Name | 4-amino-4-(2-methyl-1,3-benzothiazol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 117379404 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-amino-4-(2-methyl-1,3-benzothiazol-5-yl)butanoic acid |
| SMILES | Cc1nc2cc(C(N)CCC(=O)O)ccc2s1 |
| InChI | InChI=1S/C12H14N2O2S/c1-7-14-10-6-8(2-4-11(10)17-7)9(13)3-5-12(15)16/h2,4,6,9H,3,5,13H2,1H3,(H,15,16) |
| InChIKey | JGXCPFCXJVBBFJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |