C11H17N3O4 — CID 70434290
2-aminopentanedioic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene;hydrazine (PubChem CID 70434290) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-aminopentanedioic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene;hydrazine.
| Compound Name | 2-aminopentanedioic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene;hydrazine |
|---|---|
| PubChem CID | 70434290 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-aminopentanedioic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene;hydrazine |
| SMILES | NC(CCC(=O)O)C(=O)O.NN.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.C5H9NO4.H4N2/c1-2-5-4-6(5)3-1;6-3(5(9)10)1-2-4(7)8;1-2/h1-4H;3H,1-2,6H2,(H,7,8)(H,9,10);1-2H2 |
| InChIKey | KSJPPPYPEXPOPH-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|