C11H15NO2 — CID 68937366
2-aminopentanoic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 68937366) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-aminopentanoic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene.
| Compound Name | 2-aminopentanoic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene |
|---|---|
| PubChem CID | 68937366 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-aminopentanoic acid;bicyclo[3.1.0]hexa-1(6),2,4-triene |
| SMILES | CCCC(N)C(=O)O.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.C5H11NO2/c1-2-5-4-6(5)3-1;1-2-3-4(6)5(7)8/h1-4H;4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | LTGLPQADJWYTDY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |