C10H11IO2 — CID 175395155
bicyclo[3.1.0]hexa-1(6),2,4-triene;3-iodo-2-methylpropanoic acid (PubChem CID 175395155) has the molecular formula C10H11IO2 and a molecular weight of 290.10 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;3-iodo-2-methylpropanoic acid.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;3-iodo-2-methylpropanoic acid |
|---|---|
| PubChem CID | 175395155 |
| Molecular Formula | C10H11IO2 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;3-iodo-2-methylpropanoic acid |
| SMILES | CC(CI)C(=O)O.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.C4H7IO2/c1-2-5-4-6(5)3-1;1-3(2-5)4(6)7/h1-4H;3H,2H2,1H3,(H,6,7) |
| InChIKey | MEFJARYVOFUPCM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|