C13H17N3O3 — CID 43446952
6-amino-6-(2-oxo-1,3-dihydrobenzimidazol-5-yl)hexanoic acid (PubChem CID 43446952) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 6-amino-6-(2-oxo-1,3-dihydrobenzimidazol-5-yl)hexanoic acid.
| Compound Name | 6-amino-6-(2-oxo-1,3-dihydrobenzimidazol-5-yl)hexanoic acid |
|---|---|
| PubChem CID | 43446952 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 6-amino-6-(2-oxo-1,3-dihydrobenzimidazol-5-yl)hexanoic acid |
| SMILES | NC(CCCCC(=O)O)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H17N3O3/c14-9(3-1-2-4-12(17)18)8-5-6-10-11(7-8)16-13(19)15-10/h5-7,9H,1-4,14H2,(H,17,18)(H2,15,16,19) |
| InChIKey | FNHHQOSRLHVNPW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|