C18H36O2Si — CID 11738486
tert-butyl-dimethyl-[(1S)-1-[(2S,5S)-5-prop-2-enyloxolan-2-yl]pentoxy]silane (PubChem CID 11738486) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S)-1-[(2S,5S)-5-prop-2-enyloxolan-2-yl]pentoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1S)-1-[(2S,5S)-5-prop-2-enyloxolan-2-yl]pentoxy]silane |
|---|---|
| PubChem CID | 11738486 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | tert-butyl-dimethyl-[(1S)-1-[(2S,5S)-5-prop-2-enyloxolan-2-yl]pentoxy]silane |
| SMILES | C=CC[C@@H]1CC[C@@H]([C@H](CCCC)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C18H36O2Si/c1-8-10-12-17(20-21(6,7)18(3,4)5)16-14-13-15(19-16)11-9-2/h9,15-17H,2,8,10-14H2,1,3-7H3/t15-,16+,17+/m1/s1 |
| InChIKey | XTHMLYNHJGKVNY-IKGGRYGDSA-N |
| XLogP | 5.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|