C19H23NO3 — CID 11738506
methyl 2-[(1S,11S,12S,16S)-12-methyl-10-oxo-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6-trien-11-yl]acetate (PubChem CID 11738506) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is methyl 2-[(1S,11S,12S,16S)-12-methyl-10-oxo-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6-trien-11-yl]acetate.
| Compound Name | methyl 2-[(1S,11S,12S,16S)-12-methyl-10-oxo-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6-trien-11-yl]acetate |
|---|---|
| PubChem CID | 11738506 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | methyl 2-[(1S,11S,12S,16S)-12-methyl-10-oxo-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6-trien-11-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C(=O)N2Cc3ccccc3[C@@H]3CCC[C@]1(C)[C@H]32 |
| InChI | InChI=1S/C19H23NO3/c1-19-9-5-8-14-13-7-4-3-6-12(13)11-20(17(14)19)18(22)15(19)10-16(21)23-2/h3-4,6-7,14-15,17H,5,8-11H2,1-2H3/t14-,15+,17-,19-/m0/s1 |
| InChIKey | ZFYPNRGXKRDXRK-HIRMHNASSA-N |
| XLogP | 2.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |