C19H20F3NO3 — CID 11405940
ethyl (1S,12S,16R)-8-oxo-3-(trifluoromethyl)-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5-triene-12-carboxylate (PubChem CID 11405940) has the molecular formula C19H20F3NO3 and a molecular weight of 367.37 g/mol. Its IUPAC name is ethyl (1S,12S,16R)-8-oxo-3-(trifluoromethyl)-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5-triene-12-carboxylate.
| Compound Name | ethyl (1S,12S,16R)-8-oxo-3-(trifluoromethyl)-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5-triene-12-carboxylate |
|---|---|
| PubChem CID | 11405940 |
| Molecular Formula | C19H20F3NO3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | ethyl (1S,12S,16R)-8-oxo-3-(trifluoromethyl)-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5-triene-12-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCC[C@H]3c4c(cccc4C(F)(F)F)C(=O)N(CC1)[C@H]32 |
| InChI | InChI=1S/C19H20F3NO3/c1-2-26-17(25)18-8-4-6-11-14-12(5-3-7-13(14)19(20,21)22)16(24)23(10-9-18)15(11)18/h3,5,7,11,15H,2,4,6,8-10H2,1H3/t11-,15+,18-/m0/s1 |
| InChIKey | XMIBHTUILYHELU-POHZPAGDSA-N |
| XLogP | 3.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |