C18H21N3O2S — CID 11739416
2-[4-(2-methoxyethoxy)phenyl]-6-propan-2-ylsulfanylimidazo[1,2-b]pyridazine (PubChem CID 11739416) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[4-(2-methoxyethoxy)phenyl]-6-propan-2-ylsulfanylimidazo[1,2-b]pyridazine.
| Compound Name | 2-[4-(2-methoxyethoxy)phenyl]-6-propan-2-ylsulfanylimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 11739416 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-[4-(2-methoxyethoxy)phenyl]-6-propan-2-ylsulfanylimidazo[1,2-b]pyridazine |
| SMILES | COCCOc1ccc(-c2cn3nc(SC(C)C)ccc3n2)cc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-13(2)24-18-9-8-17-19-16(12-21(17)20-18)14-4-6-15(7-5-14)23-11-10-22-3/h4-9,12-13H,10-11H2,1-3H3 |
| InChIKey | HUANCFZTINBOBD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|