C12H13ClO2S — CID 117395420
1-(2-chloro-5-methylsulfanylphenyl)cyclobutane-1-carboxylic acid (PubChem CID 117395420) has the molecular formula C12H13ClO2S and a molecular weight of 256.75 g/mol. Its IUPAC name is 1-(2-chloro-5-methylsulfanylphenyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(2-chloro-5-methylsulfanylphenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117395420 |
| Molecular Formula | C12H13ClO2S |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 1-(2-chloro-5-methylsulfanylphenyl)cyclobutane-1-carboxylic acid |
| SMILES | CSc1ccc(Cl)c(C2(C(=O)O)CCC2)c1 |
| InChI | InChI=1S/C12H13ClO2S/c1-16-8-3-4-10(13)9(7-8)12(11(14)15)5-2-6-12/h3-4,7H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | NAULZNFEYYJBOI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |