C12H19NO3S — CID 117397124
O-[(2,6-dimethoxy-4-propan-2-ylsulfanylphenyl)methyl]hydroxylamine (PubChem CID 117397124) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is O-[(2,6-dimethoxy-4-propan-2-ylsulfanylphenyl)methyl]hydroxylamine.
| Compound Name | O-[(2,6-dimethoxy-4-propan-2-ylsulfanylphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117397124 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | O-[(2,6-dimethoxy-4-propan-2-ylsulfanylphenyl)methyl]hydroxylamine |
| SMILES | COc1cc(SC(C)C)cc(OC)c1CON |
| InChI | InChI=1S/C12H19NO3S/c1-8(2)17-9-5-11(14-3)10(7-16-13)12(6-9)15-4/h5-6,8H,7,13H2,1-4H3 |
| InChIKey | CEHKWQBONXHFHY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|