C18H19N3O5 — CID 11739804
(5S,7S)-1,3-dimethyl-7-(2-oxo-1,3-oxazolidin-3-yl)-5-phenyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine-2,4-dione (PubChem CID 11739804) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is (5S,7S)-1,3-dimethyl-7-(2-oxo-1,3-oxazolidin-3-yl)-5-phenyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine-2,4-dione.
| Compound Name | (5S,7S)-1,3-dimethyl-7-(2-oxo-1,3-oxazolidin-3-yl)-5-phenyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11739804 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | (5S,7S)-1,3-dimethyl-7-(2-oxo-1,3-oxazolidin-3-yl)-5-phenyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)[C@H](c1ccccc1)C[C@@H](N1CCOC1=O)O2 |
| InChI | InChI=1S/C18H19N3O5/c1-19-15(22)14-12(11-6-4-3-5-7-11)10-13(21-8-9-25-18(21)24)26-16(14)20(2)17(19)23/h3-7,12-13H,8-10H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | LCZKWRHEXDYLQC-STQMWFEESA-N |
| XLogP | 0.78 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |