C13H20ClNO2 — CID 117398117
2-(2-chloro-3-ethyl-5,6-dimethoxyphenyl)propan-1-amine (PubChem CID 117398117) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is 2-(2-chloro-3-ethyl-5,6-dimethoxyphenyl)propan-1-amine.
| Compound Name | 2-(2-chloro-3-ethyl-5,6-dimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 117398117 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-(2-chloro-3-ethyl-5,6-dimethoxyphenyl)propan-1-amine |
| SMILES | CCc1cc(OC)c(OC)c(C(C)CN)c1Cl |
| InChI | InChI=1S/C13H20ClNO2/c1-5-9-6-10(16-3)13(17-4)11(12(9)14)8(2)7-15/h6,8H,5,7,15H2,1-4H3 |
| InChIKey | PDBXZYUXZWPCNH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |