C10H12BrNO2 — CID 117398306
N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine (PubChem CID 117398306) has the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. Its IUPAC name is N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine.
| Compound Name | N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117398306 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine |
| SMILES | CC1Cc2cc(Br)cc(CNO)c2O1 |
| InChI | InChI=1S/C10H12BrNO2/c1-6-2-7-3-9(11)4-8(5-12-13)10(7)14-6/h3-4,6,12-13H,2,5H2,1H3 |
| InChIKey | BZFNCCQYZVBISA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|