About N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine
N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine (PubChem CID 117398306) has the molecular formula C10H12BrNO2
and a molecular weight of 258.11 g/mol. Its IUPAC name is N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine.
Molecular Properties
| Compound Name | N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine |
| PubChem CID | 117398306 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine |
| SMILES | CC1Cc2cc(Br)cc(CNO)c2O1 |
| InChI | InChI=1S/C10H12BrNO2/c1-6-2-7-3-9(11)4-8(5-12-13)10(7)14-6/h3-4,6,12-13H,2,5H2,1H3 |
| InChIKey | BZFNCCQYZVBISA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine?
The IUPAC name of N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine (CID 117398306) is N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine.
What is the SMILES notation for N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine?
The canonical SMILES for N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine is CC1Cc2cc(Br)cc(CNO)c2O1.
What is the InChIKey of N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine?
The InChIKey is BZFNCCQYZVBISA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNO2/c1-6-2-7-3-9(11)4-8(5-12-13)10(7)14-6/h3-4,6,12-13H,2,5H2,1H3.
What are the key properties of N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine?
N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine has a molecular weight of 258.11 g/mol, XLogP of 2.25, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-bromo-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]hydroxylamine is sourced from PubChem (CID 117398306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).