C13H13N3O3 — CID 117401371
4-[4-(isocyanatomethyl)phenyl]-1-methylpiperazine-2,6-dione (PubChem CID 117401371) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 4-[4-(isocyanatomethyl)phenyl]-1-methylpiperazine-2,6-dione.
| Compound Name | 4-[4-(isocyanatomethyl)phenyl]-1-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 117401371 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-[4-(isocyanatomethyl)phenyl]-1-methylpiperazine-2,6-dione |
| SMILES | CN1C(=O)CN(c2ccc(CN=C=O)cc2)CC1=O |
| InChI | InChI=1S/C13H13N3O3/c1-15-12(18)7-16(8-13(15)19)11-4-2-10(3-5-11)6-14-9-17/h2-5H,6-8H2,1H3 |
| InChIKey | CRDNVFAEFXIJJV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|