C13H11NO3S — CID 117407262
5-[3-(thietan-3-yl)phenyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 117407262) has the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. Its IUPAC name is 5-[3-(thietan-3-yl)phenyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[3-(thietan-3-yl)phenyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117407262 |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 5-[3-(thietan-3-yl)phenyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cccc(C3CSC3)c2)on1 |
| InChI | InChI=1S/C13H11NO3S/c15-13(16)11-5-12(17-14-11)9-3-1-2-8(4-9)10-6-18-7-10/h1-5,10H,6-7H2,(H,15,16) |
| InChIKey | SGTLJPBLVXEGEX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |