C18H17ClN6O2 — CID 11740767
(NZ)-N-[2-[[4-chloro-6-(3-methoxyanilino)-1,3,5-triazin-2-yl]amino]-1-phenylethylidene]hydroxylamine (PubChem CID 11740767) has the molecular formula C18H17ClN6O2 and a molecular weight of 384.83 g/mol. Its IUPAC name is (NZ)-N-[2-[[4-chloro-6-(3-methoxyanilino)-1,3,5-triazin-2-yl]amino]-1-phenylethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[2-[[4-chloro-6-(3-methoxyanilino)-1,3,5-triazin-2-yl]amino]-1-phenylethylidene]hydroxylamine |
|---|---|
| PubChem CID | 11740767 |
| Molecular Formula | C18H17ClN6O2 |
| Molecular Weight | 384.83 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (NZ)-N-[2-[[4-chloro-6-(3-methoxyanilino)-1,3,5-triazin-2-yl]amino]-1-phenylethylidene]hydroxylamine |
| SMILES | COc1cccc(Nc2nc(Cl)nc(NC/C(=N\O)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C18H17ClN6O2/c1-27-14-9-5-8-13(10-14)21-18-23-16(19)22-17(24-18)20-11-15(25-26)12-6-3-2-4-7-12/h2-10,26H,11H2,1H3,(H2,20,21,22,23,24)/b25-15+ |
| InChIKey | AOGYUCJNOYEPOR-MFKUBSTISA-N |
| XLogP | 3.57 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.83 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|