C14H17NO2S — CID 117413325
[1-(1,1-dioxo-1-benzothiophen-5-yl)cyclopentyl]methanamine (PubChem CID 117413325) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is [1-(1,1-dioxo-1-benzothiophen-5-yl)cyclopentyl]methanamine.
| Compound Name | [1-(1,1-dioxo-1-benzothiophen-5-yl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 117413325 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | [1-(1,1-dioxo-1-benzothiophen-5-yl)cyclopentyl]methanamine |
| SMILES | NCC1(c2ccc3c(c2)C=CS3(=O)=O)CCCC1 |
| InChI | InChI=1S/C14H17NO2S/c15-10-14(6-1-2-7-14)12-3-4-13-11(9-12)5-8-18(13,16)17/h3-5,8-9H,1-2,6-7,10,15H2 |
| InChIKey | PQTCRSOIFSUVLO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |