C15H24N6O7 — CID 11741693
(2S)-5-(diaminomethylideneamino)-2-[2-[2-(2,4-dioxopyrimidin-1-yl)ethoxy]ethoxycarbonylamino]pentanoic acid (PubChem CID 11741693) has the molecular formula C15H24N6O7 and a molecular weight of 400.39 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[2-[2-(2,4-dioxopyrimidin-1-yl)ethoxy]ethoxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[2-[2-(2,4-dioxopyrimidin-1-yl)ethoxy]ethoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 11741693 |
| Molecular Formula | C15H24N6O7 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[2-[2-(2,4-dioxopyrimidin-1-yl)ethoxy]ethoxycarbonylamino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)OCCOCCn1ccc(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C15H24N6O7/c16-13(17)18-4-1-2-10(12(23)24)19-15(26)28-9-8-27-7-6-21-5-3-11(22)20-14(21)25/h3,5,10H,1-2,4,6-9H2,(H,19,26)(H,23,24)(H4,16,17,18)(H,20,22,25)/t10-/m0/s1 |
| InChIKey | GHFABJLSJTZBFF-JTQLQIEISA-N |
| XLogP | -2.21 |
| TPSA | 204.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|