C16H23ClO — CID 117420897
1-[3-chloro-4-(4-methylcyclohexyl)phenyl]propan-2-ol (PubChem CID 117420897) has the molecular formula C16H23ClO and a molecular weight of 266.81 g/mol. Its IUPAC name is 1-[3-chloro-4-(4-methylcyclohexyl)phenyl]propan-2-ol.
| Compound Name | 1-[3-chloro-4-(4-methylcyclohexyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 117420897 |
| Molecular Formula | C16H23ClO |
| Molecular Weight | 266.81 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-[3-chloro-4-(4-methylcyclohexyl)phenyl]propan-2-ol |
| SMILES | CC(O)Cc1ccc(C2CCC(C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C16H23ClO/c1-11-3-6-14(7-4-11)15-8-5-13(9-12(2)18)10-16(15)17/h5,8,10-12,14,18H,3-4,6-7,9H2,1-2H3 |
| InChIKey | YKJIPTBPLLBTMP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.81 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |