C15H22FNO2 — CID 117422004
2-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]-2-methylpropan-1-ol (PubChem CID 117422004) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 2-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]-2-methylpropan-1-ol.
| Compound Name | 2-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 117422004 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]-2-methylpropan-1-ol |
| SMILES | CC(C)(CO)c1ccc(CN2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C15H22FNO2/c1-15(2,11-18)13-4-3-12(14(16)9-13)10-17-5-7-19-8-6-17/h3-4,9,18H,5-8,10-11H2,1-2H3 |
| InChIKey | PBLBRRYQGIJOHZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |