C15H21FN2O3 — CID 117477615
4-amino-4-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]butanoic acid (PubChem CID 117477615) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is 4-amino-4-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]butanoic acid.
| Compound Name | 4-amino-4-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117477615 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 4-amino-4-[3-fluoro-4-(morpholin-4-ylmethyl)phenyl]butanoic acid |
| SMILES | NC(CCC(=O)O)c1ccc(CN2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C15H21FN2O3/c16-13-9-11(14(17)3-4-15(19)20)1-2-12(13)10-18-5-7-21-8-6-18/h1-2,9,14H,3-8,10,17H2,(H,19,20) |
| InChIKey | DJLXSPJVIVSXMZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |