C15H16N2O3 — CID 117433511
8-(piperazin-1-ylmethyl)furo[2,3-f][1]benzofuran-4-ol (PubChem CID 117433511) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 8-(piperazin-1-ylmethyl)furo[2,3-f][1]benzofuran-4-ol.
| Compound Name | 8-(piperazin-1-ylmethyl)furo[2,3-f][1]benzofuran-4-ol |
|---|---|
| PubChem CID | 117433511 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 8-(piperazin-1-ylmethyl)furo[2,3-f][1]benzofuran-4-ol |
| SMILES | Oc1c2ccoc2c(CN2CCNCC2)c2ccoc12 |
| InChI | InChI=1S/C15H16N2O3/c18-13-11-2-8-19-14(11)12(10-1-7-20-15(10)13)9-17-5-3-16-4-6-17/h1-2,7-8,16,18H,3-6,9H2 |
| InChIKey | IJCBVVGCKYTHST-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |