C19H24BrN3O2S — CID 11743831
2-[2-(5-bromo-2-methoxyphenyl)ethyl]-N-[N'-(2-methylpropyl)carbamimidoyl]thiophene-3-carboxamide (PubChem CID 11743831) has the molecular formula C19H24BrN3O2S and a molecular weight of 438.39 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-N-[N'-(2-methylpropyl)carbamimidoyl]thiophene-3-carboxamide.
| Compound Name | 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-N-[N'-(2-methylpropyl)carbamimidoyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 11743831 |
| Molecular Formula | C19H24BrN3O2S |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-N-[N'-(2-methylpropyl)carbamimidoyl]thiophene-3-carboxamide |
| SMILES | COc1ccc(Br)cc1CCc1sccc1C(=O)N/C(N)=N/CC(C)C |
| InChI | InChI=1S/C19H24BrN3O2S/c1-12(2)11-22-19(21)23-18(24)15-8-9-26-17(15)7-4-13-10-14(20)5-6-16(13)25-3/h5-6,8-10,12H,4,7,11H2,1-3H3,(H3,21,22,23,24) |
| InChIKey | AWZFYTWSOFAVHK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|