C26H35BrFN5O3 — CID 142904699
N-[N'-[4-[(1-amino-1-oxopentan-2-yl)amino]butyl]carbamimidoyl]-2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzamide (PubChem CID 142904699) has the molecular formula C26H35BrFN5O3 and a molecular weight of 564.50 g/mol. Its IUPAC name is N-[N'-[4-[(1-amino-1-oxopentan-2-yl)amino]butyl]carbamimidoyl]-2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzamide.
| Compound Name | N-[N'-[4-[(1-amino-1-oxopentan-2-yl)amino]butyl]carbamimidoyl]-2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 142904699 |
| Molecular Formula | C26H35BrFN5O3 |
| Molecular Weight | 564.50 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | N-[N'-[4-[(1-amino-1-oxopentan-2-yl)amino]butyl]carbamimidoyl]-2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzamide |
| SMILES | CCCC(NCCCC/N=C(\N)NC(=O)c1cccc(F)c1CCc1cc(Br)ccc1OC)C(N)=O |
| InChI | InChI=1S/C26H35BrFN5O3/c1-3-7-22(24(29)34)31-14-4-5-15-32-26(30)33-25(35)20-8-6-9-21(28)19(20)12-10-17-16-18(27)11-13-23(17)36-2/h6,8-9,11,13,16,22,31H,3-5,7,10,12,14-15H2,1-2H3,(H2,29,34)(H3,30,32,33,35) |
| InChIKey | YSAKHKWTLOLFNQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|