C31H40BrFN4O2 — CID 59701004
N-[N'-[4-[bis(cyclopropylmethyl)amino]cyclohexyl]carbamimidoyl]-2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzamide (PubChem CID 59701004) has the molecular formula C31H40BrFN4O2 and a molecular weight of 599.59 g/mol. Its IUPAC name is N-[N'-[4-[bis(cyclopropylmethyl)amino]cyclohexyl]carbamimidoyl]-2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzamide.
| Compound Name | N-[N'-[4-[bis(cyclopropylmethyl)amino]cyclohexyl]carbamimidoyl]-2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 59701004 |
| Molecular Formula | C31H40BrFN4O2 |
| Molecular Weight | 599.59 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | N-[N'-[4-[bis(cyclopropylmethyl)amino]cyclohexyl]carbamimidoyl]-2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluorobenzamide |
| SMILES | COc1ccc(Br)cc1CCc1c(F)cccc1C(=O)N/C(N)=N/C1CCC(N(CC2CC2)CC2CC2)CC1 |
| InChI | InChI=1S/C31H40BrFN4O2/c1-39-29-16-10-23(32)17-22(29)9-15-26-27(3-2-4-28(26)33)30(38)36-31(34)35-24-11-13-25(14-12-24)37(18-20-5-6-20)19-21-7-8-21/h2-4,10,16-17,20-21,24-25H,5-9,11-15,18-19H2,1H3,(H3,34,35,36,38) |
| InChIKey | FAXILRIZQBNNRL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|