C25H26BrFN4O4 — CID 59701026
2-[[amino-[[2-[2-(5-bromo-1-benzofuran-7-yl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]-2-piperidin-4-ylacetic acid (PubChem CID 59701026) has the molecular formula C25H26BrFN4O4 and a molecular weight of 545.41 g/mol. Its IUPAC name is 2-[[amino-[[2-[2-(5-bromo-1-benzofuran-7-yl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]-2-piperidin-4-ylacetic acid.
| Compound Name | 2-[[amino-[[2-[2-(5-bromo-1-benzofuran-7-yl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]-2-piperidin-4-ylacetic acid |
|---|---|
| PubChem CID | 59701026 |
| Molecular Formula | C25H26BrFN4O4 |
| Molecular Weight | 545.41 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | 2-[[amino-[[2-[2-(5-bromo-1-benzofuran-7-yl)ethyl]-3-fluorobenzoyl]amino]methylidene]amino]-2-piperidin-4-ylacetic acid |
| SMILES | N/C(=N\C(C(=O)O)C1CCNCC1)NC(=O)c1cccc(F)c1CCc1cc(Br)cc2ccoc12 |
| InChI | InChI=1S/C25H26BrFN4O4/c26-17-12-15(22-16(13-17)8-11-35-22)4-5-18-19(2-1-3-20(18)27)23(32)31-25(28)30-21(24(33)34)14-6-9-29-10-7-14/h1-3,8,11-14,21,29H,4-7,9-10H2,(H,33,34)(H3,28,30,31,32) |
| InChIKey | BKLZQSKHCWQJEO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|