C27H32BrFN4O2 — CID 10030269
2-[2-(5-bromo-1-benzofuran-7-yl)ethyl]-3-fluoro-N-[N'-(5-pyrrolidin-1-ylpentyl)carbamimidoyl]benzamide (PubChem CID 10030269) has the molecular formula C27H32BrFN4O2 and a molecular weight of 543.48 g/mol. Its IUPAC name is 2-[2-(5-bromo-1-benzofuran-7-yl)ethyl]-3-fluoro-N-[N'-(5-pyrrolidin-1-ylpentyl)carbamimidoyl]benzamide.
| Compound Name | 2-[2-(5-bromo-1-benzofuran-7-yl)ethyl]-3-fluoro-N-[N'-(5-pyrrolidin-1-ylpentyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 10030269 |
| Molecular Formula | C27H32BrFN4O2 |
| Molecular Weight | 543.48 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 2-[2-(5-bromo-1-benzofuran-7-yl)ethyl]-3-fluoro-N-[N'-(5-pyrrolidin-1-ylpentyl)carbamimidoyl]benzamide |
| SMILES | N/C(=N\CCCCCN1CCCC1)NC(=O)c1cccc(F)c1CCc1cc(Br)cc2ccoc12 |
| InChI | InChI=1S/C27H32BrFN4O2/c28-21-17-19(25-20(18-21)11-16-35-25)9-10-22-23(7-6-8-24(22)29)26(34)32-27(30)31-12-2-1-3-13-33-14-4-5-15-33/h6-8,11,16-18H,1-5,9-10,12-15H2,(H3,30,31,32,34) |
| InChIKey | ORXMYKQYNMTBMG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|