C26H32BrFN4O2 — CID 142904691
2-[2-(5-bromo-3-ethenyl-2-hydroxyphenyl)ethyl]-3-fluoro-N-[N'-(4-pyrrolidin-1-ylbutyl)carbamimidoyl]benzamide (PubChem CID 142904691) has the molecular formula C26H32BrFN4O2 and a molecular weight of 531.47 g/mol. Its IUPAC name is 2-[2-(5-bromo-3-ethenyl-2-hydroxyphenyl)ethyl]-3-fluoro-N-[N'-(4-pyrrolidin-1-ylbutyl)carbamimidoyl]benzamide.
| Compound Name | 2-[2-(5-bromo-3-ethenyl-2-hydroxyphenyl)ethyl]-3-fluoro-N-[N'-(4-pyrrolidin-1-ylbutyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 142904691 |
| Molecular Formula | C26H32BrFN4O2 |
| Molecular Weight | 531.47 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 2-[2-(5-bromo-3-ethenyl-2-hydroxyphenyl)ethyl]-3-fluoro-N-[N'-(4-pyrrolidin-1-ylbutyl)carbamimidoyl]benzamide |
| SMILES | C=Cc1cc(Br)cc(CCc2c(F)cccc2C(=O)N/C(N)=N/CCCCN2CCCC2)c1O |
| InChI | InChI=1S/C26H32BrFN4O2/c1-2-18-16-20(27)17-19(24(18)33)10-11-21-22(8-7-9-23(21)28)25(34)31-26(29)30-12-3-4-13-32-14-5-6-15-32/h2,7-9,16-17,33H,1,3-6,10-15H2,(H3,29,30,31,34) |
| InChIKey | RWNCBDDPFIQITO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|