C26H30BrClN4O2 — CID 10347411
2-[2-(5-bromo-1-benzofuran-7-yl)ethyl]-3-chloro-N-[N'-(4-pyrrolidin-1-ylbutyl)carbamimidoyl]benzamide (PubChem CID 10347411) has the molecular formula C26H30BrClN4O2 and a molecular weight of 545.91 g/mol. Its IUPAC name is 2-[2-(5-bromo-1-benzofuran-7-yl)ethyl]-3-chloro-N-[N'-(4-pyrrolidin-1-ylbutyl)carbamimidoyl]benzamide.
| Compound Name | 2-[2-(5-bromo-1-benzofuran-7-yl)ethyl]-3-chloro-N-[N'-(4-pyrrolidin-1-ylbutyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 10347411 |
| Molecular Formula | C26H30BrClN4O2 |
| Molecular Weight | 545.91 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | 2-[2-(5-bromo-1-benzofuran-7-yl)ethyl]-3-chloro-N-[N'-(4-pyrrolidin-1-ylbutyl)carbamimidoyl]benzamide |
| SMILES | N/C(=N\CCCCN1CCCC1)NC(=O)c1cccc(Cl)c1CCc1cc(Br)cc2ccoc12 |
| InChI | InChI=1S/C26H30BrClN4O2/c27-20-16-18(24-19(17-20)10-15-34-24)8-9-21-22(6-5-7-23(21)28)25(33)31-26(29)30-11-1-2-12-32-13-3-4-14-32/h5-7,10,15-17H,1-4,8-9,11-14H2,(H3,29,30,31,33) |
| InChIKey | XUPKZBHCQIISOY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.91 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|