C34H51BrFN5O3 — CID 142904692
2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluoro-N-[N'-[4-(3-methylpiperidin-1-yl)butyl]carbamimidoyl]benzamide;N-hexan-3-ylformamide (PubChem CID 142904692) has the molecular formula C34H51BrFN5O3 and a molecular weight of 676.72 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluoro-N-[N'-[4-(3-methylpiperidin-1-yl)butyl]carbamimidoyl]benzamide;N-hexan-3-ylformamide.
| Compound Name | 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluoro-N-[N'-[4-(3-methylpiperidin-1-yl)butyl]carbamimidoyl]benzamide;N-hexan-3-ylformamide |
|---|---|
| PubChem CID | 142904692 |
| Molecular Formula | C34H51BrFN5O3 |
| Molecular Weight | 676.72 g/mol |
| Exact Mass | 675.32 |
| IUPAC Name | 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-3-fluoro-N-[N'-[4-(3-methylpiperidin-1-yl)butyl]carbamimidoyl]benzamide;N-hexan-3-ylformamide |
| SMILES | CCCC(CC)NC=O.COc1ccc(Br)cc1CCc1c(F)cccc1C(=O)N/C(N)=N/CCCCN1CCCC(C)C1 |
| InChI | InChI=1S/C27H36BrFN4O2.C7H15NO/c1-19-7-6-16-33(18-19)15-4-3-14-31-27(30)32-26(34)23-8-5-9-24(29)22(23)12-10-20-17-21(28)11-13-25(20)35-2;1-3-5-7(4-2)8-6-9/h5,8-9,11,13,17,19H,3-4,6-7,10,12,14-16,18H2,1-2H3,(H3,30,31,32,34);6-7H,3-5H2,1-2H3,(H,8,9) |
| InChIKey | ZYRYMCOPHBBGQB-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.72 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|