C32H41BrFN5O2 — CID 89155268
1-[4-[[amino-[[2-[2-[5-bromo-3-[(Z)-2-cyclopropylethenyl]-2-methylphenyl]ethyl]-3-fluorobenzoyl]amino]methylidene]amino]butyl]piperidine-4-carboxamide (PubChem CID 89155268) has the molecular formula C32H41BrFN5O2 and a molecular weight of 626.62 g/mol. Its IUPAC name is 1-[4-[[amino-[[2-[2-[5-bromo-3-[(Z)-2-cyclopropylethenyl]-2-methylphenyl]ethyl]-3-fluorobenzoyl]amino]methylidene]amino]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[amino-[[2-[2-[5-bromo-3-[(Z)-2-cyclopropylethenyl]-2-methylphenyl]ethyl]-3-fluorobenzoyl]amino]methylidene]amino]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 89155268 |
| Molecular Formula | C32H41BrFN5O2 |
| Molecular Weight | 626.62 g/mol |
| Exact Mass | 625.24 |
| IUPAC Name | 1-[4-[[amino-[[2-[2-[5-bromo-3-[(Z)-2-cyclopropylethenyl]-2-methylphenyl]ethyl]-3-fluorobenzoyl]amino]methylidene]amino]butyl]piperidine-4-carboxamide |
| SMILES | Cc1c(/C=C\C2CC2)cc(Br)cc1CCc1c(F)cccc1C(=O)N/C(N)=N/CCCCN1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C32H41BrFN5O2/c1-21-24(10-9-22-7-8-22)19-26(33)20-25(21)11-12-27-28(5-4-6-29(27)34)31(41)38-32(36)37-15-2-3-16-39-17-13-23(14-18-39)30(35)40/h4-6,9-10,19-20,22-23H,2-3,7-8,11-18H2,1H3,(H2,35,40)(H3,36,37,38,41)/b10-9- |
| InChIKey | YLNLEUJXECKFBF-KTKRTIGZSA-N |
| XLogP | 5.13 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|