C32H46BrFN4O2 — CID 142904768
2-[2-(5-bromo-2-methoxyphenyl)ethyl]-N-(N'-cyclohexylcarbamimidoyl)-3-fluorobenzamide;N-(cyclopropylmethyl)pentan-1-amine (PubChem CID 142904768) has the molecular formula C32H46BrFN4O2 and a molecular weight of 617.65 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-N-(N'-cyclohexylcarbamimidoyl)-3-fluorobenzamide;N-(cyclopropylmethyl)pentan-1-amine.
| Compound Name | 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-N-(N'-cyclohexylcarbamimidoyl)-3-fluorobenzamide;N-(cyclopropylmethyl)pentan-1-amine |
|---|---|
| PubChem CID | 142904768 |
| Molecular Formula | C32H46BrFN4O2 |
| Molecular Weight | 617.65 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | 2-[2-(5-bromo-2-methoxyphenyl)ethyl]-N-(N'-cyclohexylcarbamimidoyl)-3-fluorobenzamide;N-(cyclopropylmethyl)pentan-1-amine |
| SMILES | CCCCCNCC1CC1.COc1ccc(Br)cc1CCc1c(F)cccc1C(=O)N/C(N)=N/C1CCCCC1 |
| InChI | InChI=1S/C23H27BrFN3O2.C9H19N/c1-30-21-13-11-16(24)14-15(21)10-12-18-19(8-5-9-20(18)25)22(29)28-23(26)27-17-6-3-2-4-7-17;1-2-3-4-7-10-8-9-5-6-9/h5,8-9,11,13-14,17H,2-4,6-7,10,12H2,1H3,(H3,26,27,28,29);9-10H,2-8H2,1H3 |
| InChIKey | WQEBJGXHUVYYHR-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.65 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|