C14H18O6 — CID 117453495
ethyl 2-hydroxy-2-[3-methoxy-2-(oxetan-3-yloxy)phenyl]acetate (PubChem CID 117453495) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-[3-methoxy-2-(oxetan-3-yloxy)phenyl]acetate.
| Compound Name | ethyl 2-hydroxy-2-[3-methoxy-2-(oxetan-3-yloxy)phenyl]acetate |
|---|---|
| PubChem CID | 117453495 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | ethyl 2-hydroxy-2-[3-methoxy-2-(oxetan-3-yloxy)phenyl]acetate |
| SMILES | CCOC(=O)C(O)c1cccc(OC)c1OC1COC1 |
| InChI | InChI=1S/C14H18O6/c1-3-19-14(16)12(15)10-5-4-6-11(17-2)13(10)20-9-7-18-8-9/h4-6,9,12,15H,3,7-8H2,1-2H3 |
| InChIKey | BWGKDMBGUJPASE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |