C16H23F2NO — CID 117455589
2-(difluoromethyl)-6-(piperidin-2-ylmethyl)-4-propan-2-ylphenol (PubChem CID 117455589) has the molecular formula C16H23F2NO and a molecular weight of 283.36 g/mol. Its IUPAC name is 2-(difluoromethyl)-6-(piperidin-2-ylmethyl)-4-propan-2-ylphenol.
| Compound Name | 2-(difluoromethyl)-6-(piperidin-2-ylmethyl)-4-propan-2-ylphenol |
|---|---|
| PubChem CID | 117455589 |
| Molecular Formula | C16H23F2NO |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-(difluoromethyl)-6-(piperidin-2-ylmethyl)-4-propan-2-ylphenol |
| SMILES | CC(C)c1cc(CC2CCCCN2)c(O)c(C(F)F)c1 |
| InChI | InChI=1S/C16H23F2NO/c1-10(2)11-7-12(8-13-5-3-4-6-19-13)15(20)14(9-11)16(17)18/h7,9-10,13,16,19-20H,3-6,8H2,1-2H3 |
| InChIKey | JJYZFMRXVRRBMH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |