C12H15F2NO — CID 84691153
2-(difluoromethyl)-6-(pyrrolidin-2-ylmethyl)phenol (PubChem CID 84691153) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is 2-(difluoromethyl)-6-(pyrrolidin-2-ylmethyl)phenol.
| Compound Name | 2-(difluoromethyl)-6-(pyrrolidin-2-ylmethyl)phenol |
|---|---|
| PubChem CID | 84691153 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-(difluoromethyl)-6-(pyrrolidin-2-ylmethyl)phenol |
| SMILES | Oc1c(CC2CCCN2)cccc1C(F)F |
| InChI | InChI=1S/C12H15F2NO/c13-12(14)10-5-1-3-8(11(10)16)7-9-4-2-6-15-9/h1,3,5,9,12,15-16H,2,4,6-7H2 |
| InChIKey | CSAMUJHKEZOFNR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |