About 1-(7-bromo-1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid
1-(7-bromo-1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid (PubChem CID 117458701) has the molecular formula C11H9BrO4
and a molecular weight of 285.09 g/mol. Its IUPAC name is 1-(7-bromo-1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid.
Analyze 1-(7-bromo-1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-bromo-1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid?
The IUPAC name of 1-(7-bromo-1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid (CID 117458701) is 1-(7-bromo-1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-(7-bromo-1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-(7-bromo-1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid is O=C(O)C1(c2cc(Br)c3c(c2)OCO3)CC1.
What is the InChIKey of 1-(7-bromo-1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid?
The InChIKey is KORMWLZZLNJNPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrO4/c12-7-3-6(11(1-2-11)10(13)14)4-8-9(7)16-5-15-8/h3-4H,1-2,5H2,(H,13,14).
What are the key properties of 1-(7-bromo-1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid?
1-(7-bromo-1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid has a molecular weight of 285.09 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-bromo-1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 117458701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).