C15H16O — CID 11745937
[(1R,2R)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol (PubChem CID 11745937) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is [(1R,2R)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol.
| Compound Name | [(1R,2R)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol |
|---|---|
| PubChem CID | 11745937 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | [(1R,2R)-1,2-dimethyl-2H-acenaphthylen-1-yl]methanol |
| SMILES | C[C@@H]1c2cccc3cccc(c23)[C@]1(C)CO |
| InChI | InChI=1S/C15H16O/c1-10-12-7-3-5-11-6-4-8-13(14(11)12)15(10,2)9-16/h3-8,10,16H,9H2,1-2H3/t10-,15-/m1/s1 |
| InChIKey | CNLXZIICRQHIGG-MEBBXXQBSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |