C13H19NS3 — CID 117460049
2-[3,4,5-tris(methylsulfanyl)phenyl]pyrrolidine (PubChem CID 117460049) has the molecular formula C13H19NS3 and a molecular weight of 285.50 g/mol. Its IUPAC name is 2-[3,4,5-tris(methylsulfanyl)phenyl]pyrrolidine.
| Compound Name | 2-[3,4,5-tris(methylsulfanyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 117460049 |
| Molecular Formula | C13H19NS3 |
| Molecular Weight | 285.50 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-[3,4,5-tris(methylsulfanyl)phenyl]pyrrolidine |
| SMILES | CSc1cc(C2CCCN2)cc(SC)c1SC |
| InChI | InChI=1S/C13H19NS3/c1-15-11-7-9(10-5-4-6-14-10)8-12(16-2)13(11)17-3/h7-8,10,14H,4-6H2,1-3H3 |
| InChIKey | KZEJAKGJDVRCCD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |