4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid

C17H18O4 — CID 117461796

IUPAC4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid
SMILESCc1cc2c(CCCC(=O)O)c3oc(C)cc3c(C)c2o1
InChIInChI=1S/C17H18O4/c1-9-7-13-11(3)16-14(8-10(2)20-16)12(17(13)21-9)5-4-6-15(18)19/h7-8H,4-6H2,1-3H3,(H,18,19)
InChIKeyMWTABHGLALCFMG-UHFFFAOYSA-N
MW286.33 g/mol
LogP4.51
Rot. Bonds4

About 4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid

4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid (PubChem CID 117461796) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid.

Molecular Properties

Compound Name4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid
PubChem CID117461796
Molecular FormulaC17H18O4
Molecular Weight286.33 g/mol
Exact Mass286.12
IUPAC Name4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid
SMILESCc1cc2c(CCCC(=O)O)c3oc(C)cc3c(C)c2o1
InChIInChI=1S/C17H18O4/c1-9-7-13-11(3)16-14(8-10(2)20-16)12(17(13)21-9)5-4-6-15(18)19/h7-8H,4-6H2,1-3H3,(H,18,19)
InChIKeyMWTABHGLALCFMG-UHFFFAOYSA-N
XLogP4.51
TPSA63.58 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.33
LogP ≤ 54.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid?
The IUPAC name of 4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid (CID 117461796) is 4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid.
What is the SMILES notation for 4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid?
The canonical SMILES for 4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid is Cc1cc2c(CCCC(=O)O)c3oc(C)cc3c(C)c2o1.
What is the InChIKey of 4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid?
The InChIKey is MWTABHGLALCFMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O4/c1-9-7-13-11(3)16-14(8-10(2)20-16)12(17(13)21-9)5-4-6-15(18)19/h7-8H,4-6H2,1-3H3,(H,18,19).
What are the key properties of 4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid?
4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid has a molecular weight of 286.33 g/mol, XLogP of 4.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6,8-trimethylfuro[2,3-f][1]benzofuran-4-yl)butanoic acid is sourced from PubChem (CID 117461796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).