C14H24S — CID 11746289
3,5-ditert-butyl-2,7-dihydrothiepine (PubChem CID 11746289) has the molecular formula C14H24S and a molecular weight of 224.41 g/mol. Its IUPAC name is 3,5-ditert-butyl-2,7-dihydrothiepine.
| Compound Name | 3,5-ditert-butyl-2,7-dihydrothiepine |
|---|---|
| PubChem CID | 11746289 |
| Molecular Formula | C14H24S |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3,5-ditert-butyl-2,7-dihydrothiepine |
| SMILES | CC(C)(C)C1=CCSCC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C14H24S/c1-13(2,3)11-7-8-15-10-12(9-11)14(4,5)6/h7,9H,8,10H2,1-6H3 |
| InChIKey | SFISCZSNFWVMDW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |