C13H20S2 — CID 14024944
4,6-ditert-butylthiopyran-2-thione (PubChem CID 14024944) has the molecular formula C13H20S2 and a molecular weight of 240.44 g/mol. Its IUPAC name is 4,6-ditert-butylthiopyran-2-thione.
| Compound Name | 4,6-ditert-butylthiopyran-2-thione |
|---|---|
| PubChem CID | 14024944 |
| Molecular Formula | C13H20S2 |
| Molecular Weight | 240.44 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4,6-ditert-butylthiopyran-2-thione |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)sc(=S)c1 |
| InChI | InChI=1S/C13H20S2/c1-12(2,3)9-7-10(13(4,5)6)15-11(14)8-9/h7-8H,1-6H3 |
| InChIKey | WEQRKDSTGBIDBN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|