C13H22S — CID 123141820
1,4-ditert-butylthiopyran (PubChem CID 123141820) has the molecular formula C13H22S and a molecular weight of 210.39 g/mol. Its IUPAC name is 1,4-ditert-butylthiopyran.
| Compound Name | 1,4-ditert-butylthiopyran |
|---|---|
| PubChem CID | 123141820 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1,4-ditert-butylthiopyran |
| SMILES | CC(C)(C)C1=CC=S(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C13H22S/c1-12(2,3)11-7-9-14(10-8-11)13(4,5)6/h7-10H,1-6H3 |
| InChIKey | LTPNECSRQIDEDV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|