C14H14N2O — CID 11746325
(1R,5S)-1-(cyclohexen-1-yl)-4-oxobicyclo[3.1.0]hexane-6,6-dicarbonitrile (PubChem CID 11746325) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is (1R,5S)-1-(cyclohexen-1-yl)-4-oxobicyclo[3.1.0]hexane-6,6-dicarbonitrile.
| Compound Name | (1R,5S)-1-(cyclohexen-1-yl)-4-oxobicyclo[3.1.0]hexane-6,6-dicarbonitrile |
|---|---|
| PubChem CID | 11746325 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (1R,5S)-1-(cyclohexen-1-yl)-4-oxobicyclo[3.1.0]hexane-6,6-dicarbonitrile |
| SMILES | N#CC1(C#N)[C@H]2C(=O)CC[C@]21C1=CCCCC1 |
| InChI | InChI=1S/C14H14N2O/c15-8-13(9-16)12-11(17)6-7-14(12,13)10-4-2-1-3-5-10/h4,12H,1-3,5-7H2/t12-,14+/m1/s1 |
| InChIKey | ULHLTPOZZUIZMX-OCCSQVGLSA-N |
| XLogP | 2.50 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|