C24H32CaN4O6 — CID 24892869
CID 24892869 (PubChem CID 24892869) has the molecular formula C24H32CaN4O6 and a molecular weight of 512.62 g/mol.
| Compound Name | CID 24892869 |
|---|---|
| PubChem CID | 24892869 |
| Molecular Formula | C24H32CaN4O6 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | — |
| SMILES | CCC1(C2=CCCCC2)C(=O)NC(=O)NC1=O.CCC1(C2=CCCCC2)C(=O)NC(=O)NC1=O.[Ca] |
| InChI | InChI=1S/2C12H16N2O3.Ca/c2*1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16;/h2*6H,2-5,7H2,1H3,(H2,13,14,15,16,17); |
| InChIKey | VTWDCFPFEZUVRL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|