C12H15N2NaO2S — CID 23716080
sodium 5-(cyclohexen-1-yl)-5-ethyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione (PubChem CID 23716080) has the molecular formula C12H15N2NaO2S and a molecular weight of 274.32 g/mol. Its IUPAC name is sodium 5-(cyclohexen-1-yl)-5-ethyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione.
| Compound Name | sodium 5-(cyclohexen-1-yl)-5-ethyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione |
|---|---|
| PubChem CID | 23716080 |
| Molecular Formula | C12H15N2NaO2S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | sodium 5-(cyclohexen-1-yl)-5-ethyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione |
| SMILES | CCC1(C2=CCCCC2)C(=O)[N-]C(=S)NC1=O.[Na+] |
| InChI | InChI=1S/C12H16N2O2S.Na/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16;/h6H,2-5,7H2,1H3,(H2,13,14,15,16,17);/q;+1/p-1 |
| InChIKey | NLCXJPUARXCFKD-UHFFFAOYSA-M |
| XLogP | -0.80 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|