C12H16CaN2O3+2 — CID 23618796
calcium 5-(cyclohexen-1-yl)-5-ethyl-1,3-diazinane-2,4,6-trione (PubChem CID 23618796) has the molecular formula C12H16CaN2O3+2 and a molecular weight of 276.35 g/mol. Its IUPAC name is calcium 5-(cyclohexen-1-yl)-5-ethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | calcium 5-(cyclohexen-1-yl)-5-ethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 23618796 |
| Molecular Formula | C12H16CaN2O3+2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | calcium 5-(cyclohexen-1-yl)-5-ethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(C2=CCCCC2)C(=O)NC(=O)NC1=O.[Ca+2] |
| InChI | InChI=1S/C12H16N2O3.Ca/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16;/h6H,2-5,7H2,1H3,(H2,13,14,15,16,17);/q;+2 |
| InChIKey | WLFGRJGVFJFWQK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|