C17H21NO3 — CID 117463717
7-(1-isocyanatocyclobutyl)-6-propan-2-yl-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 117463717) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 7-(1-isocyanatocyclobutyl)-6-propan-2-yl-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-(1-isocyanatocyclobutyl)-6-propan-2-yl-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 117463717 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 7-(1-isocyanatocyclobutyl)-6-propan-2-yl-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | CC(C)c1c(C2(N=C=O)CCC2)ccc2c1OCCCO2 |
| InChI | InChI=1S/C17H21NO3/c1-12(2)15-13(17(18-11-19)7-3-8-17)5-6-14-16(15)21-10-4-9-20-14/h5-6,12H,3-4,7-10H2,1-2H3 |
| InChIKey | WZKRNQGLZQFVDF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|