C14H14FNO2 — CID 117370100
4-fluoro-5-(1-isocyanatocyclopentyl)-2,3-dihydro-1-benzofuran (PubChem CID 117370100) has the molecular formula C14H14FNO2 and a molecular weight of 247.27 g/mol. Its IUPAC name is 4-fluoro-5-(1-isocyanatocyclopentyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 4-fluoro-5-(1-isocyanatocyclopentyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 117370100 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 4-fluoro-5-(1-isocyanatocyclopentyl)-2,3-dihydro-1-benzofuran |
| SMILES | O=C=NC1(c2ccc3c(c2F)CCO3)CCCC1 |
| InChI | InChI=1S/C14H14FNO2/c15-13-10-5-8-18-12(10)4-3-11(13)14(16-9-17)6-1-2-7-14/h3-4H,1-2,5-8H2 |
| InChIKey | VSQAILJLDHUHCE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|