C14H15NO5S — CID 117494119
6-(1-isocyanatocyclobutyl)-5-methylsulfonyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 117494119) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is 6-(1-isocyanatocyclobutyl)-5-methylsulfonyl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(1-isocyanatocyclobutyl)-5-methylsulfonyl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 117494119 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 6-(1-isocyanatocyclobutyl)-5-methylsulfonyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | CS(=O)(=O)c1c(C2(N=C=O)CCC2)ccc2c1OCCO2 |
| InChI | InChI=1S/C14H15NO5S/c1-21(17,18)13-10(14(15-9-16)5-2-6-14)3-4-11-12(13)20-8-7-19-11/h3-4H,2,5-8H2,1H3 |
| InChIKey | YOTIQWGRRWPEJA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|